C19H29N3O2 — CID 119392750
4-(2,5-dimethylphenyl)-4-oxo-N-(3-piperazin-1-ylpropyl)butanamide (PubChem CID 119392750) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-4-oxo-N-(3-piperazin-1-ylpropyl)butanamide.
| Compound Name | 4-(2,5-dimethylphenyl)-4-oxo-N-(3-piperazin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 119392750 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-4-oxo-N-(3-piperazin-1-ylpropyl)butanamide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-15-4-5-16(2)17(14-15)18(23)6-7-19(24)21-8-3-11-22-12-9-20-10-13-22/h4-5,14,20H,3,6-13H2,1-2H3,(H,21,24) |
| InChIKey | BDXKNFFALOVGOJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|