C12H14O2 — CID 19917258
1-(2,4-dimethylphenyl)butane-1,3-dione (PubChem CID 19917258) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)butane-1,3-dione.
| Compound Name | 1-(2,4-dimethylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 19917258 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(2,4-dimethylphenyl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H14O2/c1-8-4-5-11(9(2)6-8)12(14)7-10(3)13/h4-6H,7H2,1-3H3 |
| InChIKey | YMJBWCNZIKCHER-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|