C11H11FO2 — CID 55262326
1-(4-fluoro-2-methylphenyl)butane-1,3-dione (PubChem CID 55262326) has the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)butane-1,3-dione.
| Compound Name | 1-(4-fluoro-2-methylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 55262326 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C11H11FO2/c1-7-5-9(12)3-4-10(7)11(14)6-8(2)13/h3-5H,6H2,1-2H3 |
| InChIKey | ALALPEOVTJDLLN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|