C11H10F4O — CID 79954422
4,4,4-trifluoro-1-(4-fluoro-2-methylphenyl)butan-1-one (PubChem CID 79954422) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-fluoro-2-methylphenyl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-(4-fluoro-2-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 79954422 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-fluoro-2-methylphenyl)butan-1-one |
| SMILES | Cc1cc(F)ccc1C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H10F4O/c1-7-6-8(12)2-3-9(7)10(16)4-5-11(13,14)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | QQRKGCUTLAZGOD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |