C19H20O4 — CID 139946472
1-(2,4-dimethylphenyl)-3-[4-(2-hydroxyethoxy)phenyl]propane-1,3-dione (PubChem CID 139946472) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[4-(2-hydroxyethoxy)phenyl]propane-1,3-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[4-(2-hydroxyethoxy)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 139946472 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[4-(2-hydroxyethoxy)phenyl]propane-1,3-dione |
| SMILES | Cc1ccc(C(=O)CC(=O)c2ccc(OCCO)cc2)c(C)c1 |
| InChI | InChI=1S/C19H20O4/c1-13-3-8-17(14(2)11-13)19(22)12-18(21)15-4-6-16(7-5-15)23-10-9-20/h3-8,11,20H,9-10,12H2,1-2H3 |
| InChIKey | JBQQBPOKSABRKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|