C18H20N2O3 — CID 7600016
N'-(4-ethoxybenzoyl)-2,4-dimethylbenzohydrazide (PubChem CID 7600016) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-2,4-dimethylbenzohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 7600016 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-2,4-dimethylbenzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-4-23-15-8-6-14(7-9-15)17(21)19-20-18(22)16-10-5-12(2)11-13(16)3/h5-11H,4H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | QLWMXRFZYNNSNM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|