C19H23NO2 — CID 94843664
N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-4-ethoxybenzamide (PubChem CID 94843664) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-4-ethoxybenzamide.
| Compound Name | N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 94843664 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[(1S)-1-(2,4-dimethylphenyl)ethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H](C)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-5-22-17-9-7-16(8-10-17)19(21)20-15(4)18-11-6-13(2)12-14(18)3/h6-12,15H,5H2,1-4H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | UNEPAUQCXVTHAY-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |