C21H25NO2 — CID 132650929
N-[1-(2,4-dimethylphenyl)propyl]-4-prop-2-enoxybenzamide (PubChem CID 132650929) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)propyl]-4-prop-2-enoxybenzamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)propyl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 132650929 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)propyl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NC(CC)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-5-13-24-18-10-8-17(9-11-18)21(23)22-20(6-2)19-12-7-15(3)14-16(19)4/h5,7-12,14,20H,1,6,13H2,2-4H3,(H,22,23) |
| InChIKey | JCTWECAOEDQEKA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|