C23H30N2O — CID 94014114
N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(pyrrolidin-1-ylmethyl)benzamide (PubChem CID 94014114) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(pyrrolidin-1-ylmethyl)benzamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(pyrrolidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 94014114 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(pyrrolidin-1-ylmethyl)benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(CN2CCCC2)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C23H30N2O/c1-4-22(21-12-7-17(2)15-18(21)3)24-23(26)20-10-8-19(9-11-20)16-25-13-5-6-14-25/h7-12,15,22H,4-6,13-14,16H2,1-3H3,(H,24,26)/t22-/m1/s1 |
| InChIKey | YAYLFGMUFSMCAE-JOCHJYFZSA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |