C24H32N2O — CID 46766789
N-[1-(2,4-dimethylphenyl)propyl]-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 46766789) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)propyl]-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)propyl]-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46766789 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)propyl]-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | CCC(NC(=O)c1ccc(CN2CCCCC2)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C24H32N2O/c1-4-23(22-13-8-18(2)16-19(22)3)25-24(27)21-11-9-20(10-12-21)17-26-14-6-5-7-15-26/h8-13,16,23H,4-7,14-15,17H2,1-3H3,(H,25,27) |
| InChIKey | LIBHIQSOLWLAOM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |