C22H25N3O — CID 94014126
N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 94014126) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 94014126 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylphenyl)propyl]-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(Cn2ccnc2)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C22H25N3O/c1-4-21(20-10-5-16(2)13-17(20)3)24-22(26)19-8-6-18(7-9-19)14-25-12-11-23-15-25/h5-13,15,21H,4,14H2,1-3H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | HTPFQXBWOIIYFX-OAQYLSRUSA-N |
| XLogP | 4.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |