C23H31NO2 — CID 132653395
2-(4-tert-butylphenoxy)-N-[1-(2,4-dimethylphenyl)propyl]acetamide (PubChem CID 132653395) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[1-(2,4-dimethylphenyl)propyl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[1-(2,4-dimethylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 132653395 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[1-(2,4-dimethylphenyl)propyl]acetamide |
| SMILES | CCC(NC(=O)COc1ccc(C(C)(C)C)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C23H31NO2/c1-7-21(20-13-8-16(2)14-17(20)3)24-22(25)15-26-19-11-9-18(10-12-19)23(4,5)6/h8-14,21H,7,15H2,1-6H3,(H,24,25) |
| InChIKey | QDFSQADLAWHQQR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |