C20H25NO4 — CID 2807075
N-[1-(2,4-dimethylphenyl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 2807075) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2807075 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)c2ccc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H25NO4/c1-12-7-8-16(13(2)9-12)14(3)21-20(22)15-10-17(23-4)19(25-6)18(11-15)24-5/h7-11,14H,1-6H3,(H,21,22) |
| InChIKey | LPKRBIPBHPAWQH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |