C22H20O3 — CID 2462834
1-(2,4-dimethylphenyl)-2-(4-phenoxyphenoxy)ethanone (PubChem CID 2462834) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-(4-phenoxyphenoxy)ethanone.
| Compound Name | 1-(2,4-dimethylphenyl)-2-(4-phenoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 2462834 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-(4-phenoxyphenoxy)ethanone |
| SMILES | Cc1ccc(C(=O)COc2ccc(Oc3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H20O3/c1-16-8-13-21(17(2)14-16)22(23)15-24-18-9-11-20(12-10-18)25-19-6-4-3-5-7-19/h3-14H,15H2,1-2H3 |
| InChIKey | QPWDMMCOIZDRGJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |