C22H27BO4 — CID 58696140
1-(2,4-dimethylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone (PubChem CID 58696140) has the molecular formula C22H27BO4 and a molecular weight of 366.27 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone.
| Compound Name | 1-(2,4-dimethylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 58696140 |
| Molecular Formula | C22H27BO4 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanone |
| SMILES | Cc1ccc(C(=O)COc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H27BO4/c1-15-7-12-19(16(2)13-15)20(24)14-25-18-10-8-17(9-11-18)23-26-21(3,4)22(5,6)27-23/h7-13H,14H2,1-6H3 |
| InChIKey | SVYFLUJVHILIJB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|