C17H18O2S — CID 60624137
1-(2,5-dimethylphenyl)-2-(4-methylsulfanylphenoxy)ethanone (PubChem CID 60624137) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(4-methylsulfanylphenoxy)ethanone.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(4-methylsulfanylphenoxy)ethanone |
|---|---|
| PubChem CID | 60624137 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(4-methylsulfanylphenoxy)ethanone |
| SMILES | CSc1ccc(OCC(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C17H18O2S/c1-12-4-5-13(2)16(10-12)17(18)11-19-14-6-8-15(20-3)9-7-14/h4-10H,11H2,1-3H3 |
| InChIKey | GVQKAPOINCPPFZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |