C18H19BrO2 — CID 107725175
2-(4-bromo-3,5-dimethylphenoxy)-1-(2,5-dimethylphenyl)ethanone (PubChem CID 107725175) has the molecular formula C18H19BrO2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)-1-(2,5-dimethylphenyl)ethanone.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)-1-(2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 107725175 |
| Molecular Formula | C18H19BrO2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)-1-(2,5-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C)c(C(=O)COc2cc(C)c(Br)c(C)c2)c1 |
| InChI | InChI=1S/C18H19BrO2/c1-11-5-6-12(2)16(7-11)17(20)10-21-15-8-13(3)18(19)14(4)9-15/h5-9H,10H2,1-4H3 |
| InChIKey | IPKNPJZIZSTLMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |