C16H12F4O2 — CID 112778164
1-(2,4-dimethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone (PubChem CID 112778164) has the molecular formula C16H12F4O2 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone.
| Compound Name | 1-(2,4-dimethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
|---|---|
| PubChem CID | 112778164 |
| Molecular Formula | C16H12F4O2 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
| SMILES | Cc1ccc(C(=O)COc2c(F)c(F)cc(F)c2F)c(C)c1 |
| InChI | InChI=1S/C16H12F4O2/c1-8-3-4-10(9(2)5-8)13(21)7-22-16-14(19)11(17)6-12(18)15(16)20/h3-6H,7H2,1-2H3 |
| InChIKey | CMZUHAKBPFVSQJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|