C21H17F4NO2 — CID 7467709
1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone (PubChem CID 7467709) has the molecular formula C21H17F4NO2 and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone.
| Compound Name | 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
|---|---|
| PubChem CID | 7467709 |
| Molecular Formula | C21H17F4NO2 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(1-benzyl-2,5-dimethylpyrrol-3-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
| SMILES | Cc1cc(C(=O)COc2c(F)c(F)cc(F)c2F)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H17F4NO2/c1-12-8-15(13(2)26(12)10-14-6-4-3-5-7-14)18(27)11-28-21-19(24)16(22)9-17(23)20(21)25/h3-9H,10-11H2,1-2H3 |
| InChIKey | NAMMRVPTZOXCFA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|