C12H14F2O2 — CID 82006063
2-(2,2-difluoroethoxy)-1-(2,4-dimethylphenyl)ethanone (PubChem CID 82006063) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-(2,2-difluoroethoxy)-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 82006063 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)COCC(F)F)c(C)c1 |
| InChI | InChI=1S/C12H14F2O2/c1-8-3-4-10(9(2)5-8)11(15)6-16-7-12(13)14/h3-5,12H,6-7H2,1-2H3 |
| InChIKey | FCMULFCDCOBZPT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |