C10H8Cl2F2O2 — CID 82006425
1-(2,5-dichlorophenyl)-2-(2,2-difluoroethoxy)ethanone (PubChem CID 82006425) has the molecular formula C10H8Cl2F2O2 and a molecular weight of 269.07 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2,2-difluoroethoxy)ethanone.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2,2-difluoroethoxy)ethanone |
|---|---|
| PubChem CID | 82006425 |
| Molecular Formula | C10H8Cl2F2O2 |
| Molecular Weight | 269.07 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2,2-difluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)F)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2F2O2/c11-6-1-2-8(12)7(3-6)9(15)4-16-5-10(13)14/h1-3,10H,4-5H2 |
| InChIKey | PVSRUCKCBRWIAR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |