2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid

C10H8Cl2O4 — CID 61329924

IUPAC2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid
SMILESO=C(O)COCC(=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C10H8Cl2O4/c11-6-1-2-8(12)7(3-6)9(13)4-16-5-10(14)15/h1-3H,4-5H2,(H,14,15)
InChIKeyHBEXZNBIZUJLEC-UHFFFAOYSA-N
MW263.08 g/mol
LogP2.28
Rot. Bonds5

About 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid

2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid (PubChem CID 61329924) has the molecular formula C10H8Cl2O4 and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid
PubChem CID61329924
Molecular FormulaC10H8Cl2O4
Molecular Weight263.08 g/mol
Exact Mass261.98
IUPAC Name2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid
SMILESO=C(O)COCC(=O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C10H8Cl2O4/c11-6-1-2-8(12)7(3-6)9(13)4-16-5-10(14)15/h1-3H,4-5H2,(H,14,15)
InChIKeyHBEXZNBIZUJLEC-UHFFFAOYSA-N
XLogP2.28
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.08
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid?
The IUPAC name of 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid (CID 61329924) is 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid.
What is the SMILES notation for 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid?
The canonical SMILES for 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid is O=C(O)COCC(=O)c1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid?
The InChIKey is HBEXZNBIZUJLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O4/c11-6-1-2-8(12)7(3-6)9(13)4-16-5-10(14)15/h1-3H,4-5H2,(H,14,15).
What are the key properties of 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid?
2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid has a molecular weight of 263.08 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dichlorophenyl)-2-oxoethoxy]acetic acid is sourced from PubChem (CID 61329924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).