C10H10Cl2O3S — CID 114969573
1-(2,5-dichlorophenyl)-3-methylsulfonylpropan-1-one (PubChem CID 114969573) has the molecular formula C10H10Cl2O3S and a molecular weight of 281.16 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-methylsulfonylpropan-1-one.
| Compound Name | 1-(2,5-dichlorophenyl)-3-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 114969573 |
| Molecular Formula | C10H10Cl2O3S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-methylsulfonylpropan-1-one |
| SMILES | CS(=O)(=O)CCC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H10Cl2O3S/c1-16(14,15)5-4-10(13)8-6-7(11)2-3-9(8)12/h2-3,6H,4-5H2,1H3 |
| InChIKey | LLLSAZLQGCDDSV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |