C17H14Cl2O3 — CID 90363445
1-(2,5-dichlorophenyl)-4-(2-methoxyphenyl)butane-1,4-dione (PubChem CID 90363445) has the molecular formula C17H14Cl2O3 and a molecular weight of 337.20 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-4-(2-methoxyphenyl)butane-1,4-dione.
| Compound Name | 1-(2,5-dichlorophenyl)-4-(2-methoxyphenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 90363445 |
| Molecular Formula | C17H14Cl2O3 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-4-(2-methoxyphenyl)butane-1,4-dione |
| SMILES | COc1ccccc1C(=O)CCC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2O3/c1-22-17-5-3-2-4-12(17)15(20)8-9-16(21)13-10-11(18)6-7-14(13)19/h2-7,10H,8-9H2,1H3 |
| InChIKey | IUNWCZXFZWUURD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |