C17H16Cl2N2O3 — CID 108538079
2,5-dichloro-N-[2-[(2-methoxybenzoyl)amino]ethyl]benzamide (PubChem CID 108538079) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(2-methoxybenzoyl)amino]ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[(2-methoxybenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108538079 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2,5-dichloro-N-[2-[(2-methoxybenzoyl)amino]ethyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-24-15-5-3-2-4-12(15)16(22)20-8-9-21-17(23)13-10-11(18)6-7-14(13)19/h2-7,10H,8-9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OWPXYDZYLCTXBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|