C10H12Cl2N2O — CID 62659102
2,5-dichloro-N-[2-(methylamino)ethyl]benzamide (PubChem CID 62659102) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 62659102 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2,5-dichloro-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-13-4-5-14-10(15)8-6-7(11)2-3-9(8)12/h2-3,6,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | STGAIRGXYVRQSX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|