C12H15Cl2N3O2 — CID 108573425
2,5-dichloro-N-[2-(dimethylcarbamoylamino)ethyl]benzamide (PubChem CID 108573425) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(dimethylcarbamoylamino)ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(dimethylcarbamoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108573425 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2,5-dichloro-N-[2-(dimethylcarbamoylamino)ethyl]benzamide |
| SMILES | CN(C)C(=O)NCCNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2N3O2/c1-17(2)12(19)16-6-5-15-11(18)9-7-8(13)3-4-10(9)14/h3-4,7H,5-6H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | NFQUEFXDMVNHMK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|