C13H19Cl2N3O2 — CID 83120511
3-[2-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83120511) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 3-[2-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83120511 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-[2-[[2-(2,5-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H19Cl2N3O2/c1-18(2)13(20)17-6-5-16-8-12(19)10-7-9(14)3-4-11(10)15/h3-4,7,12,16,19H,5-6,8H2,1-2H3,(H,17,20) |
| InChIKey | HDNFLDURRHFSFJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|