C14H21Cl3N2O2 — CID 22769475
N-[2-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride (PubChem CID 22769475) has the molecular formula C14H21Cl3N2O2 and a molecular weight of 355.69 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride.
| Compound Name | N-[2-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 22769475 |
| Molecular Formula | C14H21Cl3N2O2 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[2-[[2-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]ethyl]-2-methylpropanamide;hydrochloride |
| SMILES | CC(C)C(=O)NCCNCC(O)c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C14H20Cl2N2O2.ClH/c1-9(2)14(20)18-6-5-17-8-13(19)10-3-4-11(15)12(16)7-10;/h3-4,7,9,13,17,19H,5-6,8H2,1-2H3,(H,18,20);1H |
| InChIKey | VDIWCLPTUZHZLD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|