C13H15Cl2NO — CID 114160110
1-(2,5-dichlorophenyl)-2-(pent-4-ynylamino)ethanol (PubChem CID 114160110) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(pent-4-ynylamino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(pent-4-ynylamino)ethanol |
|---|---|
| PubChem CID | 114160110 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(pent-4-ynylamino)ethanol |
| SMILES | C#CCCCNCC(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-3-4-7-16-9-13(17)11-8-10(14)5-6-12(11)15/h1,5-6,8,13,16-17H,3-4,7,9H2 |
| InChIKey | NBTQIOOQMLANAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|