C13H15Cl2N3O — CID 61463037
1-(2,5-dichlorophenyl)-2-(2-imidazol-1-ylethylamino)ethanol (PubChem CID 61463037) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(2-imidazol-1-ylethylamino)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(2-imidazol-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 61463037 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(2-imidazol-1-ylethylamino)ethanol |
| SMILES | OC(CNCCn1ccnc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2N3O/c14-10-1-2-12(15)11(7-10)13(19)8-16-3-5-18-6-4-17-9-18/h1-2,4,6-7,9,13,16,19H,3,5,8H2 |
| InChIKey | SSSBCRIHRUUECV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|