C11H15N3O2 — CID 61462995
1-(furan-2-yl)-2-(2-imidazol-1-ylethylamino)ethanol (PubChem CID 61462995) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(2-imidazol-1-ylethylamino)ethanol.
| Compound Name | 1-(furan-2-yl)-2-(2-imidazol-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 61462995 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-(furan-2-yl)-2-(2-imidazol-1-ylethylamino)ethanol |
| SMILES | OC(CNCCn1ccnc1)c1ccco1 |
| InChI | InChI=1S/C11H15N3O2/c15-10(11-2-1-7-16-11)8-12-3-5-14-6-4-13-9-14/h1-2,4,6-7,9-10,12,15H,3,5,8H2 |
| InChIKey | NNPUFZZSRNCUCM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|