C15H21N3O3 — CID 61463199
1-(2-imidazol-1-ylethylamino)-3-(2-methoxyphenoxy)propan-2-ol (PubChem CID 61463199) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethylamino)-3-(2-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-(2-imidazol-1-ylethylamino)-3-(2-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 61463199 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-(2-imidazol-1-ylethylamino)-3-(2-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccccc1OCC(O)CNCCn1ccnc1 |
| InChI | InChI=1S/C15H21N3O3/c1-20-14-4-2-3-5-15(14)21-11-13(19)10-16-6-8-18-9-7-17-12-18/h2-5,7,9,12-13,16,19H,6,8,10-11H2,1H3 |
| InChIKey | BOBQYHHJEXCFFW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|