C17H25N3O2 — CID 25421946
(2R)-1-(3,5-dimethylphenoxy)-3-(3-imidazol-1-ylpropylamino)propan-2-ol (PubChem CID 25421946) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R)-1-(3,5-dimethylphenoxy)-3-(3-imidazol-1-ylpropylamino)propan-2-ol.
| Compound Name | (2R)-1-(3,5-dimethylphenoxy)-3-(3-imidazol-1-ylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 25421946 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2R)-1-(3,5-dimethylphenoxy)-3-(3-imidazol-1-ylpropylamino)propan-2-ol |
| SMILES | Cc1cc(C)cc(OC[C@H](O)CNCCCn2ccnc2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-14-8-15(2)10-17(9-14)22-12-16(21)11-18-4-3-6-20-7-5-19-13-20/h5,7-10,13,16,18,21H,3-4,6,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | RKXBWBCFXRWBEF-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|