C8H13F2N3 — CID 115406678
N-(2,2-difluoroethyl)-3-imidazol-1-ylpropan-1-amine (PubChem CID 115406678) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115406678 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-imidazol-1-ylpropan-1-amine |
| SMILES | FC(F)CNCCCn1ccnc1 |
| InChI | InChI=1S/C8H13F2N3/c9-8(10)6-11-2-1-4-13-5-3-12-7-13/h3,5,7-8,11H,1-2,4,6H2 |
| InChIKey | VLWMAIFIWFSAJY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|