C12H17N3OS — CID 106435002
2-(3-imidazol-1-ylpropylamino)-1-thiophen-3-ylethanol (PubChem CID 106435002) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropylamino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(3-imidazol-1-ylpropylamino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435002 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(3-imidazol-1-ylpropylamino)-1-thiophen-3-ylethanol |
| SMILES | OC(CNCCCn1ccnc1)c1ccsc1 |
| InChI | InChI=1S/C12H17N3OS/c16-12(11-2-7-17-9-11)8-13-3-1-5-15-6-4-14-10-15/h2,4,6-7,9-10,12-13,16H,1,3,5,8H2 |
| InChIKey | YQGCZZDSULKGQV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|