C11H20N2OS — CID 106435161
2-[3-(dimethylamino)propylamino]-1-thiophen-3-ylethanol (PubChem CID 106435161) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[3-(dimethylamino)propylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435161 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-1-thiophen-3-ylethanol |
| SMILES | CN(C)CCCNCC(O)c1ccsc1 |
| InChI | InChI=1S/C11H20N2OS/c1-13(2)6-3-5-12-8-11(14)10-4-7-15-9-10/h4,7,9,11-12,14H,3,5-6,8H2,1-2H3 |
| InChIKey | KLMKLRYRIOSEPI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|