C8H12FNOS — CID 106435014
2-(2-fluoroethylamino)-1-thiophen-3-ylethanol (PubChem CID 106435014) has the molecular formula C8H12FNOS and a molecular weight of 189.25 g/mol. Its IUPAC name is 2-(2-fluoroethylamino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(2-fluoroethylamino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435014 |
| Molecular Formula | C8H12FNOS |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-(2-fluoroethylamino)-1-thiophen-3-ylethanol |
| SMILES | OC(CNCCF)c1ccsc1 |
| InChI | InChI=1S/C8H12FNOS/c9-2-3-10-5-8(11)7-1-4-12-6-7/h1,4,6,8,10-11H,2-3,5H2 |
| InChIKey | CKJQLGSDBHMPNQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|