C9H14N2O3S — CID 106435892
2-amino-3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoic acid (PubChem CID 106435892) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-amino-3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoic acid.
| Compound Name | 2-amino-3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 106435892 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-amino-3-[(2-hydroxy-2-thiophen-3-ylethyl)amino]propanoic acid |
| SMILES | NC(CNCC(O)c1ccsc1)C(=O)O |
| InChI | InChI=1S/C9H14N2O3S/c10-7(9(13)14)3-11-4-8(12)6-1-2-15-5-6/h1-2,5,7-8,11-12H,3-4,10H2,(H,13,14) |
| InChIKey | XTHWKLHQOVSPPH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |