C16H16N2OS2 — CID 103685198
2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 103685198) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103685198 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | OC(CNCc1nc(-c2ccccc2)cs1)c1ccsc1 |
| InChI | InChI=1S/C16H16N2OS2/c19-15(13-6-7-20-10-13)8-17-9-16-18-14(11-21-16)12-4-2-1-3-5-12/h1-7,10-11,15,17,19H,8-9H2 |
| InChIKey | QKWJUJYUMCZUAV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |