C17H19N3OS — CID 111440398
2-[(1-benzylpyrazol-4-yl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 111440398) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 111440398 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | OC(CNCc1cnn(Cc2ccccc2)c1)c1ccsc1 |
| InChI | InChI=1S/C17H19N3OS/c21-17(16-6-7-22-13-16)10-18-8-15-9-19-20(12-15)11-14-4-2-1-3-5-14/h1-7,9,12-13,17-18,21H,8,10-11H2 |
| InChIKey | KSHMQCKQXABDII-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |