C13H18N4 — CID 60888359
N'-[(1-benzylpyrazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 60888359) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N'-[(1-benzylpyrazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(1-benzylpyrazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60888359 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N'-[(1-benzylpyrazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H18N4/c14-6-7-15-8-13-9-16-17(11-13)10-12-4-2-1-3-5-12/h1-5,9,11,15H,6-8,10,14H2 |
| InChIKey | OIXGOXWMHIPECV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|