C18H20N4O2S — CID 122198913
4-[[(1-benzylpyrazol-4-yl)methylamino]methyl]benzenesulfonamide (PubChem CID 122198913) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-[[(1-benzylpyrazol-4-yl)methylamino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(1-benzylpyrazol-4-yl)methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122198913 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-[[(1-benzylpyrazol-4-yl)methylamino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNCc2cnn(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C18H20N4O2S/c19-25(23,24)18-8-6-15(7-9-18)10-20-11-17-12-21-22(14-17)13-16-4-2-1-3-5-16/h1-9,12,14,20H,10-11,13H2,(H2,19,23,24) |
| InChIKey | DWXYDXNQHYTCBS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |