C11H14N4 — CID 130820345
(1-benzylpyrazol-4-yl)methylhydrazine (PubChem CID 130820345) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is (1-benzylpyrazol-4-yl)methylhydrazine.
| Compound Name | (1-benzylpyrazol-4-yl)methylhydrazine |
|---|---|
| PubChem CID | 130820345 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1-benzylpyrazol-4-yl)methylhydrazine |
| SMILES | NNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C11H14N4/c12-13-6-11-7-14-15(9-11)8-10-4-2-1-3-5-10/h1-5,7,9,13H,6,8,12H2 |
| InChIKey | FYKWCUADUBOMCK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|