C15H19N3 — CID 115635172
N-[(1-benzylpyrazol-4-yl)methyl]-1-methylcyclopropan-1-amine (PubChem CID 115635172) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-1-methylcyclopropan-1-amine.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-1-methylcyclopropan-1-amine |
|---|---|
| PubChem CID | 115635172 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-1-methylcyclopropan-1-amine |
| SMILES | CC1(NCc2cnn(Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C15H19N3/c1-15(7-8-15)16-9-14-10-17-18(12-14)11-13-5-3-2-4-6-13/h2-6,10,12,16H,7-9,11H2,1H3 |
| InChIKey | GBCWHWSMCNLIFK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |