C13H18N4 — CID 83005209
2-[(1-benzylpyrazol-4-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 83005209) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83005209 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H18N4/c1-16(2)14-8-13-9-15-17(11-13)10-12-6-4-3-5-7-12/h3-7,9,11,14H,8,10H2,1-2H3 |
| InChIKey | RUUBCNLHPJHMGN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|