About N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine
N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 55025337) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine |
| PubChem CID | 55025337 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H20N4/c15-7-4-8-16-9-14-10-17-18(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,10,12,16H,4,7-9,11,15H2 |
| InChIKey | BBJZLHCMGGTHQG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine?
The IUPAC name of N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine (CID 55025337) is N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine is NCCCNCc1cnn(Cc2ccccc2)c1.
What is the InChIKey of N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine?
The InChIKey is BBJZLHCMGGTHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4/c15-7-4-8-16-9-14-10-17-18(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,10,12,16H,4,7-9,11,15H2.
What are the key properties of N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine?
N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine has a molecular weight of 244.34 g/mol, XLogP of 1.37, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1-benzylpyrazol-4-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 55025337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).