C15H19N3O2 — CID 60782827
4-[(1-benzylpyrazol-4-yl)methylamino]butanoic acid (PubChem CID 60782827) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[(1-benzylpyrazol-4-yl)methylamino]butanoic acid.
| Compound Name | 4-[(1-benzylpyrazol-4-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 60782827 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[(1-benzylpyrazol-4-yl)methylamino]butanoic acid |
| SMILES | O=C(O)CCCNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H19N3O2/c19-15(20)7-4-8-16-9-14-10-17-18(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,10,12,16H,4,7-9,11H2,(H,19,20) |
| InChIKey | AVEGWHXJIZZERC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|