C21H22N4O3S — CID 9080575
(E)-3-(1-benzylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 9080575) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is (E)-3-(1-benzylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9080575 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (E)-3-(1-benzylpyrazol-4-yl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)/C=C/c2cnn(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c22-29(27,28)20-9-6-17(7-10-20)12-13-23-21(26)11-8-19-14-24-25(16-19)15-18-4-2-1-3-5-18/h1-11,14,16H,12-13,15H2,(H,23,26)(H2,22,27,28)/b11-8+ |
| InChIKey | YCSJQRVPLCDLLN-DHZHZOJOSA-N |
| XLogP | 1.95 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|