C22H21N3O5S — CID 34427802
3-[[4-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 34427802) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-[[4-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[[4-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 34427802 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-[[4-[(E)-3-(1-benzylpyrazol-4-yl)prop-2-enoyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccc(C(=O)/C=C/c2cnn(Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H21N3O5S/c26-21(11-6-18-14-23-25(16-18)15-17-4-2-1-3-5-17)19-7-9-20(10-8-19)31(29,30)24-13-12-22(27)28/h1-11,14,16,24H,12-13,15H2,(H,27,28)/b11-6+ |
| InChIKey | WGFMGZSZZNZFPA-IZZDOVSWSA-N |
| XLogP | 2.58 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|